3',5'-Di-O-acetyl-5-bromo-2'-deoxy-2'-fluorouridine
3',5'-Di-O-acetyl-5-bromo-2'-deoxy-2'-fluorouridine is a potent antiviral compound widely used in biomedical research. It has demonstrated efficacy against various viruses, including influenza and herpes simplex viruses. This compound inhibits viral replication by interfering with the viral DNA/RNA synthesis process. Its unique chemical structure makes it a valuable tool in studying viral pathogenesis and designing targeted therapeutic strategies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1188522-91-9 |
| Pricing | Inquire |
| Cas | 1188522-91-9 |
| Molecular Weight | 409.16 |
| Molecular Formula | C13H14BrFN2O7 |
| Canonical SMILES | CC(=O)OCC1C(C(C(O1)N2C=C(C(=O)NC2=O)Br)F)OC(=O)C |