2-(2-Chlorobenzyloxy)phenylboronic acid
2-(2-Chlorobenzyloxy)phenylboronic acid is a specialized reagent in biomedical research, often used in the synthesis of cancer therapeutic drugs. Its primary role lies in the creation of controlled substance inhibitors aimed at treating conditions like leukemia and lymphoma.
| Supplier | BOC Sciences |
|---|---|
| Product # | 870777-21-2 |
| Pricing | Inquire |
| Cas | 870777-21-2 |
| Molecular Weight | 262.50 |
| Molecular Formula | C13H12BClO3 |
| Canonical SMILES | B(C1=CC=CC=C1OCC2=CC=CC=C2Cl)(O)O |