3'-Deoxy-5-fluoro-3'-methyluridine
3'-Deoxy-5-fluoro-3'-methyluridine is a revolutionary nucleoside analogue, serving as a potent antidote in research of viral adversaries, such as herpes and the notorious respiratory syncytial virus (RSV). Employing its unparalleled prowess, it meticulously thwarts the replication of viral DNA and RNA, effectively crippling their destructive potential.
| Supplier | BOC Sciences |
|---|---|
| Product # | 37731-67-2 |
| Pricing | Inquire |
| Cas | 37731-67-2 |
| Molecular Weight | 260.22 |
| Molecular Formula | C10H13FN2O5 |
| Canonical SMILES | CC1C(OC(C1O)N2C=C(C(=O)NC2=O)F)CO |