trans-Loperamide N-Oxide
Loperamide oxide (LOPOX) is a prodrug of Loperamide (LOP). It is concluded that Loperamide oxide administered intraluminally is reduced to Loperamide and has the same antisecretory potency as Loperamide in jejunum and colon.
| Supplier | BOC Sciences |
|---|---|
| Product # | 106900-12-3 |
| Pricing | Inquire |
| Cas | 106900-12-3 |
| Molecular Weight | 493.04 |
| Molecular Formula | C29H33ClN2O3 |
| Canonical SMILES | CN(C)C(=O)C(CC[N+]1(CCC(CC1)(C2=CC=C(C=C2)Cl)O)[O-])(C3=CC=CC=C3)C4=CC=CC=C4 |