5'-O-DMT-5-iodouridine
5'-O-DMT-5-iodouridine, an extraordinary compound thriving in the biomedical realm, plays a pivotal role within the pharmaceutical sphere. Facilitating the evolution of nucleoside-based medicinal concoctions, this remarkable product revolutionizes the therapeutic landscape, championing the battle against afflictions such as viral infections and particular variants of malignancy. Its inherent molecular idiosyncrasies position it as an invaluable asset, empowering the arsenal of biomedicine by propelling precision healthcare and enabling targeted remedial interventions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 158728-68-8 |
| Pricing | Inquire |
| Cas | 158728-68-8 |
| Molecular Weight | 672.46 |
| Molecular Formula | C30H29IN2O8 |
| Canonical SMILES | COC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)OCC4C(C(C(O4)N5C=C(C(=O)NC5=O)I)O)O |