(R)-(+)-SLV 319
(R)-(+)-SLV 319 is a less active enantiomer of SLV 319, which is a central cannabinoid (CB1) receptor antagonist. SLV 319 has the potential to treat neuroinflammatory disorders, cognitive disorders, septic shock, obesity, psychosis, addiction, and gastrointestinal disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 656827-86-0 |
| Pricing | Inquire |
| Cas | 656827-86-0 |
| Molecular Weight | 487.4 |
| Molecular Formula | C23H20Cl2N4O2S |
| Canonical SMILES | CN=C(NS(=O)(=O)C1=CC=C(C=C1)Cl)N2CC(C(=N2)C3=CC=C(C=C3)Cl)C4=CC=CC=C4 |