3-(5'-O-Dimethoxytrityl)-β-D-2-deoxyribofuranosyl)-6-methylpyrrolo[2,3-d]pyrimidin-2-one
3-(5'-O-Dimethoxytrityl)-β-D-2-deoxyribofuranosyl)-6-methylpyrrolo[2,3-d]pyrimidin-2-one, referred to as DMTMDP, is prized for its significant role in the research and development of nucleosides and nucleotides. This invaluable chemical entity displaying remarkable potential in the reserch of diverse afflictions, spanning from viral infections to malignancies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 644962-87-8 |
| Pricing | Inquire |
| Cas | 644962-87-8 |
| Molecular Weight | 567.64 |
| Molecular Formula | C33H33N3O6 |
| Canonical SMILES | CC1=CC2=CN(C(=O)N=C2N1)C3CC(C(O3)COC(C4=CC=CC=C4)(C5=CC=C(C=C5)OC)C6=CC=C(C=C6)OC)O |