Cdc7-IN-1
Cdc7-IN-1 is a highly potent, selective and ATP competitive Cdc7 kinase inhibitor, with an IC50 of 0.6 nM at 1 mM ATP and a slow deceleration characteristic. It can effectively inhibit the activity of Cdc7 in cancer cells and induce cell death.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1402055-25-7 |
| Pricing | Inquire |
| Cas | 1402055-25-7 |
| Molecular Weight | 409.82 |
| Molecular Formula | C21H16ClN3O4 |
| Canonical SMILES | CCOC(=O)C1=C(NC2C=CC=CC=2Cl)O/C(=C\C2=CNC3N=CC=CC2=3)/C1=O |