P-PHENYLENEDIPROPIONIC ACID
P-PHENYLENEDIPROPIONIC ACID is an extensively employed biomedicine chemical compound that showcases its proficiency in the curative approach against oxidative stress-related ailments. Functioning as a remarkable antioxidant, it shields cellular structures against the injurious impacts induced by free radicals. This acid serves as a viable therapeutic option for a wide array of ailments comprising neurodegenerative disorders, atherosclerosis, and age-related macular degeneration.
| Supplier | BOC Sciences |
|---|---|
| Product # | 4251-21-2 |
| Pricing | Inquire |
| Cas | 4251-21-2 |
| Molecular Weight | 222.24 |
| Molecular Formula | C12H14O4 |
| Canonical SMILES | C1=CC(=CC=C1CCC(=O)O)CCC(=O)O |