Porcn-IN-1
Porcn-IN-1 is a potent porcupine inhibitor with an IC50 of 0.5±0.2 nM. It inhibits secretion of Wnt3A from Wnt3A-transfected HEK293T cells when used at a concentration of 0.1 μM, indicating inhibition of porcupine, an enzyme that catalyzes palmitoylation of Wnt proteins.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2036044-77-4 |
| Pricing | Inquire |
| Cas | 2036044-77-4 |
| Molecular Weight | 410.44 |
| Molecular Formula | C25H19FN4O |
| Canonical SMILES | CC1=NC=CC(=C1)C2=C(C=C(C=N2)CNC(=O)C3=CC4=C(C=C3)C5=CC=CC=C5N4)F |