Doxycycline EP Impurity C
Doxycycline EP Impurity C is an impurity of Doxycycline, which is a semisynthetic, broad-spectrum tetracycline antibiotic used in the treatment of infections caused by bacteria and certain parasites.
Supplier | BOC Sciences |
---|---|
Product # | 6543-77-7 |
Pricing | Inquire |
Cas | 6543-77-7 |
Molecular Weight | 444.43 |
Molecular Formula | C22H24N2O8 |
Canonical SMILES | O=C(N)C=1C(=O)C2(O)C(O)=C3C(=O)C=4C(O)=CC=CC4C(C)C3C(O)C2C(C1O)N(C)C |