Anacardic acid triene
Anacardic acid is a blanket term applied to a family of closely related compounds consisting of salicylic acid with a 15-carbon alkyl chain, which exist either in a fully saturated form or as a monoene, diene, or triene. Anacardic acid triene is a polyunsaturated form of anacardic acid that has been found in cashew nut shell liquid. Anacardic acid triene inhibits NADH oxidase with IC50 of 1.3 µg/ml, which is an enzyme involved in bacterial respiration. Anacardic acid triene is molluscicidal, inducing toxicity in B. glabrata (LC50 = 0.35 ppm), but is inactive against S. mansoni parasites.
| Supplier | BOC Sciences |
|---|---|
| Product # | 103904-73-0 |
| Pricing | Inquire |
| Cas | 103904-73-0 |
| Molecular Weight | 342.47 |
| Molecular Formula | C22H30O3 |
| Canonical SMILES | OC1=CC=CC(CCCCCCC/C=C\C/C=C\CC=C)=C1C(O)=O |