8-Methoxy Psoralen-[13C,d3]
Labelled Methoxy Psoralen. Methoxsalen, also called xanthotoxin, marketed under the trade names Oxsoralen, Deltasoralen, Meladinine, is a drug used to treat psoriasis, eczema, vitiligo, and some cutaneous lymphomas in conjunction with exposing the skin to UVA light from lamps or sunlight.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-003151 |
| Pricing | Inquire |
| Cas | 1246819-63-5 |
| Molecular Weight | 220.20 |
| Molecular Formula | C12H8O4 |
| Canonical SMILES | COC1=C2C(=CC3=C1OC=C3)C=CC(=O)O2 |