Melithiazol B
Melithiazol B is an antibiotic produced by Melittangium lichenicila Mel26, Archangium gephyra Ar 7747 and Myxococcus stipitatus Mx s 64. It is a β-methoxyacrylate (MOA) inhibitor with strong anti-agent activity. Antifungal and cytotoxic agent.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-01907 |
| Pricing | Inquire |
| Cas | 170894-31-2 |
| Molecular Weight | 420.54 |
| Molecular Formula | C20H24N2O4S2 |
| Canonical SMILES | CC(C(C=CC1=CSC(=N1)C2=CSC(=N2)C(=C)C)OC)C(=CC(=O)OC)OC |