Decyl b-D-thioglucopyranoside
Decyl b-D-thioglucopyranoside is a versatile compound, offers immense potential in the research of a wide range of diseases associated with cell surface glycoconjugates. This non-ionic detergent, highly prevalent in biochemistry and molecular biology research, is predominantly utilized for the isolation, purification and solubilization of membrane proteins. Moreover, it serves as a crucial component in the investigation of glycoproteins, lectins and diverse glycoconjugates.
| Supplier | BOC Sciences |
|---|---|
| Product # | 98854-16-1 |
| Pricing | Inquire |
| Cas | 98854-16-1 |
| Molecular Weight | 336.49 |
| Molecular Formula | C16H32O5S |
| Canonical SMILES | CCCCCCCCCCSC1C(C(C(C(O1)CO)O)O)O |