2-Amino-2',5-dichlorobenzophenone
2-Amino-2',5-dichlorobenzophenone is a key intermediate in the synthesis of pharmaceuticals and research chemicals. It is used in the production of anticancer drugs and antitumor agents due to its potential to inhibit cancer cell growth. Additionally, it finds application in the research of various diseases related to cell proliferation and apoptosis.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP2988 |
| Pricing | Inquire |
| Cas | 2958-36-3 |
| Molecular Weight | 266.12 |
| Molecular Formula | C13H9Cl2NO |
| Canonical SMILES | C1=CC=C(C(=C1)C(=O)C2=C(C=CC(=C2)Cl)N)Cl |