Miconazole Impurity B
Miconazole Impurity B, is the impurity of Miconazole, which is an imidazole antifungal agent, that is applied topically to the skin or to mucus membranes for the treatment of fungal infections.
Supplier | BOC Sciences |
---|---|
Product # | 913837-72-6 |
Pricing | Inquire |
Cas | 913837-72-6 |
Molecular Weight | 381.68 |
Molecular Formula | C18H15Cl3N2O |
Canonical SMILES | C1=CC(=CC(=C1)Cl)COC(CN2C=CN=C2)C3=C(C=C(C=C3)Cl)Cl |