DMTr-2'-O-TBDMS-5-Cl-rU-3'-CE-Phosphoramidite
DMTr-2'-O-TBDMS-5-Cl-rU-3'-CE-Phosphoramidite is a chemical compound used in oligonucleotide synthesis. It protects the 5'-hydroxyl group with a DMTr group and stabilizes the ribose sugar with a 2'-O-TBDMS modification. Additionally, it incorporates 5-chloro-uridine as a modified nucleoside. The 3'-CE phosphoramidite facilitates nucleotide addition during synthesis. This compound allows for the controlled synthesis of oligonucleotides with specific modifications, important for various applications in molecular biology and biotechnology.
| Supplier | BOC Sciences |
|---|---|
| Product # | BRP-00558 |
| Pricing | Inquire |
| Molecular Weight | 895.50 |
| Molecular Formula | C45H60ClN4O9PSi |
| Canonical SMILES | CC(C)N(C(C)C)P(OCCC#N)OC1C(OC(C1O[Si](C)(C)C(C)(C)C)N2C=C(C(=O)NC2=O)Cl)COC(C3=CC=CC=C3)(C4=CC=C(C=C4)OC)C5=CC=C(C=C5)OC |