Pz-1
Pz-1 is a cell-permeable, non-cytotoxic (up to 0.1 μM and 6 days; NIH/3T3 cells), and highly potent RET and VEGFR2 inhibitor with IC50s of less than 1 nM for both wild type kinases.
| Supplier | BOC Sciences |
|---|---|
| Product # | B0084-267746 |
| Pricing | Inquire |
| Cas | 1800505-64-9 |
| Molecular Weight | 454.52 |
| Molecular Formula | C26H26N6O2 |
| Canonical SMILES | O=C(NC1=NOC(C(C)(C)C)=C1)CC2=CC=C(N3C4=CC=C(C5=CN(C)N=C5)C=C4N=C3)C=C2 |