(S)-N-(5-AMINO-1-CARBOXYPENTYL)IMINODIACETIC ACID HYDRATE
A nitrilotriacetic acid derivative used as a metal chelating adsorbent for metal ion affinity chromatography. This method can be used for identification and rapid one-step purification of gene products expressed as fusion proteins with an oligo-histidine.
| Supplier | BOC Sciences |
|---|---|
| Product # | 113231-05-3 |
| Pricing | Inquire |
| Cas | 113231-05-3 |
| Molecular Weight | 262.26 |
| Molecular Formula | C10H18N2O6 |
| Canonical SMILES | C(CCN)CC(C(=O)O)N(CC(=O)O)CC(=O)O |