6-Bnz-cAMP sodium salt
6-Bnz-cAMP sodium salt is a cell-permeable cAMP analogue that selectively activates cAMP-dependent PKA but not Epac signaling pathways. It inhibits the proliferation of vascular smooth muscle cell in combination with 8-CPT-2Me-cAMP.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1135306-29-4 |
| Pricing | Inquire |
| Cas | 1135306-29-4 |
| Molecular Weight | 455.29 |
| Molecular Formula | C17H15N5NaO7P |
| Canonical SMILES | C1C2C(C(C(O2)N3C=NC4=C3N=CN=C4NC(=O)C5=CC=CC=C5)O)OP(=O)(O1)[O-].[Na+] |