Piliformic acid
Piliformic acid is a fungal metabolite originally isolated from N. pseudotrichia and it has diverse biological activities. It is active against L. braziliensis amastigotes (IC50 = 78.5 µM). It is also active against the plant pathogenic fungi C. gloeosporioides (MIC = 292 µM). Piliformic acid is cytotoxic to BC-1 human breast cancer cells (IC50 = 5 µg/ml).
| Supplier | BOC Sciences |
|---|---|
| Product # | 98985-76-3 |
| Pricing | Inquire |
| Cas | 98985-76-3 |
| Molecular Weight | 214.26 |
| Molecular Formula | C11H18O4 |
| Canonical SMILES | CCCCCC=C(C(C)C(=O)O)C(=O)O |