Poly(2-Fluoro-2-Deoxyadenylic Acid)
Poly(2-Fluoro-2-Deoxyadenylic Acid) is a synthetic polymer widely used in the biomedical industry. It exhibits great potential in targeted drug delivery. This unique polymer can be engineered to encapsulate chemocompounds, enhancing their stability and increasing their selectivity towards cancer cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | 68245-92-1 |
| Pricing | Inquire |
| Cas | 68245-92-1 |
| Molecular Weight | 443.18 |
| Molecular Formula | C10H12FN5O10P2 |
| Canonical SMILES | C1=NC2=C(N=C(N=C2N1C3C(C(C(O3)COP(=O)(O)[O-])OP(=O)(O)[O-])O)F)N |