5-Naphthyl-b-methylaminocarbony-3'-O-acetyl-2'-O-methyluridine
5-Naphthyl-b-methylaminocarbony-3'-O-acetyl-2'-O-methyluridine is an influential biochemical compound extensively employed in the biomedical domain, standing out as an intrinsic building block for the research of diverse pharmacological remedies targeting viral afflictions such as hepatitis C and HIV.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2095417-03-9 |
| Pricing | Inquire |
| Cas | 2095417-03-9 |
| Molecular Weight | 483.47 |
| Molecular Formula | C24H25N3O8 |
| Canonical SMILES | CC(=O)OC1C(OC(C1OC)N2C=C(C(=O)NC2=O)C(=O)NCC3=CC4=CC=CC=C4C=C3)CO |