Salvianolicacid B
Salvianolic acid A is extracted from the root of Salvia miltiorrhiza Bge. It has been considered that cerebral endothelium apoptosis caused by reactive oxygen species including hydrogen peroxide (H2O2) is implicated in the pathogenesis of cerebrovascular disorders. It was shown to inhibit apoptosis in many cell types, also inhibits apoptosis that is induced by the death receptor in the HL-7702 hepatocyte cell line.
| Supplier | BOC Sciences |
|---|---|
| Product # | 115939-25-8 |
| Pricing | Inquire |
| Cas | 115939-25-8 |
| Molecular Weight | 718.61 |
| Molecular Formula | C36H30O16 |
| Canonical SMILES | C1=CC(=C(C=C1CC(C(=O)O)OC(=O)C=CC2=C3C(C(OC3=C(C=C2)O)C4=CC(=C(C=C4)O)O)C(=O)OC(CC5=CC(=C(C=C5)O)O)C(=O)O)O)O |