3',5'-Di-O-acetyl-5-fluoro-2'-O-methyluridine
3',5'-Di-O-acetyl-5-fluoro-2'-O-methyluridine is a highly potent and esteemed chemical compound, revered for its exceptional attributes with respect to research of viral infections, particularly hepatitis B and hepatitis C. This prodigious entity emerges as an instrumental component in thwarting the pernicious replication of viruses.
| Supplier | BOC Sciences |
|---|---|
| Product # | 869355-34-0 |
| Pricing | Inquire |
| Cas | 869355-34-0 |
| Molecular Weight | 360.29 |
| Molecular Formula | C14H17FN2O8 |
| Canonical SMILES | CC(=O)OCC1C(C(C(O1)N2C=C(C(=O)NC2=O)F)OC)OC(=O)C |