N6-(6-Amino)hexyl-ATP
N6-(6-Amino)hexyl-ATP is a biochemical widely used to study the structure and function of purinergic receptors. It is also used as a substrate for enzymes such as kinases and phosphotransferases. In the field of biomedicine, N6-(6-Amino)hexyl-ATP has potential applications in the treatment of neurological diseases such as epilepsy and neuropathic pain.
| Supplier | BOC Sciences |
|---|---|
| Product # | 53602-93-0 |
| Pricing | Inquire |
| Cas | 53602-93-0 |
| Molecular Weight | 606.35 (free acid) |
| Molecular Formula | C16H29N6O13P3(free acid) |
| Canonical SMILES | C1=NC(=C2C(=N1)N(C=N2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)NCCCCCCN |