Cytochalasin B
It is produced by the strain of Helminthosporium dematioideum, Coriolus vernicipes. It has many biological activities, such as inhibiting cytokinesis reversibly, inhibiting megasophil endocytosis and exocytosis. Cytosine B has immunosuppressive effects.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-01755 |
| Pricing | Inquire |
| Cas | 14930-96-2 |
| Molecular Weight | 479.61 |
| Molecular Formula | C29H37NO5 |
| Canonical SMILES | CC1CCCC(C=CC(=O)OC23C(C=CC1)C(C(=C)C(C2C(NC3=O)CC4=CC=CC=C4)C)O)O |