Phenyl 2,3,4-Tri-O-benzyl-1-thio-b-L-fucopyranoside
Phenyl 2,3,4-Tri-O-benzyl-1-thio-b-L-fucopyranoside, a remarkable biomedical substance featured on chemicalbook, showcases immense potential in the realm of disease management. With its multifaceted attributes encompassing antiviral and antitumor properties, this compound serves as a catalyst for the development of groundbreaking pharmacotherapy. Pioneering drug formulations targeting viral infections and malignancies can harness the intrinsic therapeutic efficacy embedded within this compound.
| Supplier | BOC Sciences |
|---|---|
| Product # | 167612-35-3 |
| Pricing | Inquire |
| Cas | 167612-35-3 |
| Molecular Weight | 526.69 |
| Molecular Formula | C33H34O4S |
| Canonical SMILES | CC1C(C(C(C(O1)SC2=CC=CC=C2)OCC3=CC=CC=C3)OCC4=CC=CC=C4)OCC5=CC=CC=C5 |