2-Nitrophenyl b-D-cellobioside
2-Nitrophenyl b-D-cellobioside, a chemical compound utilized in the realm of enzymology and biochemistry, finds its purpose in the detection of different types of enzymes, especially glycoside hydrolases. Its functionalities are not limited to this, however, as it can also be employed to analyze carbohydrate-binding proteins. Widely renowned for its ability to influence the development of biosensors for detecting environmental contaminants, this product stands to revolutionize the approach to the pesticide problem that currently plagues our society.
| Supplier | BOC Sciences |
|---|---|
| Product # | 70867-33-3 |
| Pricing | Inquire |
| Cas | 70867-33-3 |
| Molecular Weight | 463.39 |
| Molecular Formula | C18H25NO13 |
| Canonical SMILES | C1=CC=C(C(=C1)[N+](=O)[O-])OC2C(C(C(C(O2)CO)OC3C(C(C(C(O3)CO)O)O)O)O)O |