6-Mercapto-9-(2'-deoxy-b-D-ribofuranosyl)purine
6-Mercapto-9-(2'-deoxy-b-D-ribofuranosyl)purine, a remarkable antiviral compound extensively utilized in the biomedical field, demonstrates exceptional effectiveness against an array of diverse DNA and RNA viruses, encompassing hepatitis B and C, HIV, and herpes simplex viruses. By obstructing viral DNA/RNA synthesis and viral polymerase activity, this compound exerts a potent inhibitory effect on viral replication.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2239-64-7 |
| Pricing | Inquire |
| Cas | 2239-64-7 |
| Molecular Weight | 268.29 |
| Molecular Formula | C10H12N4O3S |
| Canonical SMILES | C1C(C(OC1N2C=NC3=C2NC=NC3=S)CO)O |