Pemetrexed Impurity 7 (Mixture of Diastereomers)
Pemetrexed Impurity 7 (mixture of diastereomers) is one of pemetrexed impurities. Pemetrexed binds to and inhibits the enzyme thymidylate synthase (TS) which catalyses the methylation of 2'-deoxyuridine-5'-monophosphate (dUMP) to 2'-deoxythymidine-5'-monophosphate (dTMP), an essential precursor in DNA synthesis.
| Supplier | BOC Sciences |
|---|---|
| Product # | 193281-00-4 |
| Pricing | Inquire |
| Cas | 193281-00-4 |
| Molecular Weight | 443.41 |
| Molecular Formula | C20H21N5O7 |
| Canonical SMILES | C1=CC(=CC=C1CCC2C3=C(NC2=O)N=C(NC3=O)N)C(=O)NC(CCC(=O)O)C(=O)O |