Epothilone D
Epothilone D is a natural polyketide compound isolated from the myxobacterium Sorangium cellulosum. Also known as desoxyepothilone B, epothilone D binds to tubulin and inhibits the disassembly of microtubules, resulting in the inhibition of mitosis, cellular proliferation, and cell motility.
Supplier | BOC Sciences |
---|---|
Product # | B0084-086493 |
Pricing | Inquire |
Cas | 189453-10-9 |
Molecular Weight | 491.68 |
Molecular Formula | C27H41NO5S |
Canonical SMILES | CC1CCCC(=CCC(OC(=O)CC(C(C(=O)C(C1O)C)(C)C)O)C(=CC2=CSC(=N2)C)C)C |