Potassium benzothiophene-3-trifluoroborate
Potassium benzothiophene-3-trifluoroborate is a vital component in the biomedical industry, utilized for the development of pharmaceutical drugs targeting various diseases. This compound plays a crucial role in the synthesis of novel therapeutic agents designed to treat conditions like cancer, inflammation, and infectious diseases. It acts as a building block for drug discovery, facilitating the creation of effective treatments for significant medical challenges.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1000160-73-5 |
| Pricing | Inquire |
| Cas | 1000160-73-5 |
| Molecular Weight | 240.09 |
| Molecular Formula | C8H5BF3KS |
| Canonical SMILES | [B-](C1=CSC2=CC=CC=C12)(F)(F)F.[K+] |