Omeprazole N1-Methyl 5-Methoxy Thiol Impurity
Omeprazole N1-Methyl 5-Methoxy Thiol Impurity is an impurity of Omeprazole. Omeprazole is a proton pump inhibitor used in the treatment of dyspepsia. It binds to the proton pump hydrogen-potassium adenosine triphosphatase (H+/K+ ATPase) and inhibits its activity and the parietal cell secretion of H+ ions into the gastric lumen.
| Supplier | BOC Sciences |
|---|---|
| Product # | 58764-00-4 |
| Pricing | Inquire |
| Cas | 58764-00-4 |
| Molecular Weight | 194.25 |
| Molecular Formula | C9H10N2OS |
| Canonical SMILES | CN1C2=C(C=C(C=C2)OC)NC1=S |