1,2,3,5-Tetra-O-acetyl-b-L-xylofuranose
1,2,3,5-Tetra-O-acetyl-b-L-xylofuranose, a vital compound in the biomedical sector, holds immense importance. Frequently utilized for synthesizing diverse pharmaceutical medications, it showcases its potential in restraining tumor growth and metastasis, instilling hope for cancer treatment. Moreover, this compound assumes a substantial role in drug R&D by acting as a pivotal intermediate for formulating innovative therapeutic agents.
| Supplier | BOC Sciences |
|---|---|
| Product # | 844877-56-1 |
| Pricing | Inquire |
| Cas | 844877-56-1 |
| Molecular Weight | 318.28 |
| Molecular Formula | C13H18O9 |
| Canonical SMILES | CC(=O)OCC1C(C(C(O1)OC(=O)C)OC(=O)C)OC(=O)C |