5'-Deoxy-5'-iodothymidine
5'-Deoxy-5'-iodothymidine, commonly referred to as dIT or Idoxuridine, holds substantial promise as a potent antiviral compound, used in the research of a spectrum of viral infections predominantly provoked by the herpes simplex virus (HSV), varicella-zoster virus (VZV) and Epstein-Barr virus (EBV). Through its ingenious mechanism, dIT seamlessly obstructs viral DNA replication by intercalating within the nascent viral DNA strand, effectively curtailing its elongation process.
| Supplier | BOC Sciences |
|---|---|
| Product # | 25953-14-4 |
| Pricing | Inquire |
| Cas | 25953-14-4 |
| Molecular Weight | 352.13 |
| Molecular Formula | C10H13IN2O4 |
| Canonical SMILES | CC1=CN(C(=O)NC1=O)C2CC(C(O2)CI)O |