N4-Acetyl-2'-deoxycytidine
N4-Acetyl-2'-deoxycytidine, a nucleoside analog employed for the amelioration of viral infections and diverse cancers, exerts a mechanism of action that hinges on obstructing DNA synthesis and, consequently, the elimination of neoplastic or infected cells. Additionally, it has demonstrated promise in combatting hepatitis B and HIV.
| Supplier | BOC Sciences |
|---|---|
| Product # | 32909-05-0 |
| Pricing | Inquire |
| Cas | 32909-05-0 |
| Molecular Weight | 269.25 |
| Molecular Formula | C11H15N3O5 |
| Canonical SMILES | CC(=O)NC1=NC(=O)N(C=C1)C2CC(C(O2)CO)O |