Hexa-His
Hexa-His, consisting of 6 His residues in a row, called His-Tag, is used as a metal binding site for the recombinant protein. His-Tag sequence can be placed on the N- or -terminal of a target protein by using vectors from various commercial molecular biology companies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 64134-30-1 |
| Pricing | Inquire |
| Cas | 64134-30-1 |
| Molecular Weight | 840.85 |
| Molecular Formula | C36H44N18O7 |
| Canonical SMILES | C1=C(NC=N1)CC(C(=O)NC(CC2=CN=CN2)C(=O)NC(CC3=CN=CN3)C(=O)NC(CC4=CN=CN4)C(=O)NC(CC5=CN=CN5)C(=O)NC(CC6=CN=CN6)C(=O)O)N |