MOTS-c (Human) acetate
MOTS-c (Human) acetate, a mitochondria-derived peptide, induces the accumulation of the AMP analog AICAR and increases the activation of AMPK and its downstream GLUT4 expression. It induces glucose uptake and improves insulin sensitivity. It has implications in regulating obesity, diabetes, exercise, and longevity.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-016171 |
| Pricing | Inquire |
| Molecular Weight | 2234.64 |
| Molecular Formula | C103H156N28O24S2 |
| Canonical SMILES | CCC(C)C(C(=O)NC(CC1=CC=CC=C1)C(=O)NC(CC2=CC=C(C=C2)O)C(=O)N3CCCC3C(=O)NC(CCCNC(=N)N)C(=O)NC(CCCCN)C(=O)NC(CC(C)C)C(=O)NC(CCCNC(=N)N)C(=O)O)NC(=O)C(CC4=CC=C(C=C4)O)NC(=O)CNC(=O)C(CCSC)NC(=O)C(CCC(=O)O)NC(=O)C(CCC(=O)N)NC(=O)C(CC5=CNC6=CC=CC=C65)NC(=O)C(CCCNC(=N)N)NC(=O)C(CCSC)N.CC(=O)O |