2,6-Dichloropurine-9-beta-D-(2'-deoxy-3',5'-di-O-benzoyl-2'-fluoro)arabinoriboside
2,6-Dichloropurine-9-beta-D-(2'-deoxy-3',5'-di-O-benzoyl-2'-fluoro)arabinoriboside is a chemical compound mainly used in the pharmacological field due to its antiviral activity. It is commonly prescribed for the treatment of herpes simplex virus type 1 and type 2 infections, as well as varicella zoster virus infections. Additionally, it has shown promising results in inhibiting the proliferation of cancer cells, and it is being researched for its potential therapeutic applications in chemotherapy.
| Supplier | BOC Sciences |
|---|---|
| Product # | 329187-80-6 |
| Pricing | Inquire |
| Cas | 329187-80-6 |
| Molecular Weight | 531.32 |
| Molecular Formula | C24H17Cl2FN4O5 |
| Canonical SMILES | C1=CC=C(C=C1)C(=O)OCC2C(C(C(O2)N3C=NC4=C3N=C(N=C4Cl)Cl)F)OC(=O)C5=CC=CC=C5 |