4arm-Poly(lactide-co-glycolide)
| Supplier | CD Formulation |
|---|---|
| Product # | MSMN-066 |
| Pricing | 100 mg, Inquire for price |
| product1 | Polymers |
| Administration route | Biocompatible and biodegradable polymer. Can be used in the formation of nanoparticles for drug delivery. The multi-arm molecular structure might promote high drug loading, superior colloidal stability, as well as long circulation time. |
| Molecular Formula | C5H8O4((((C3H4O2)x(C2H2O2)y)m)H)4 |
| Purity | 4 arm PLGA |