Benzyl-PEG1-N3
Benzyl-PEG1-N3 is a PEG linker with an acid labile, benzyl protecting group. The azide can participate in copper-catalyzed Click Chemistry reactions with alkynes, DBCO and BCN moieties. The hydrophilic PEG linker increases the water solubility of the compound in aqueous media.
| Supplier | BOC Sciences |
|---|---|
| Product # | BPG-1211 |
| Pricing | Inquire |
| Cas | 66021-75-8 |
| Molecular Weight | 177.21 |
| Molecular Formula | C9H11N3O |
| Canonical SMILES | C1=CC=C(C=C1)COCCN=[N+]=[N-] |