Rifaximin EP Impurity C
Rifaximin EP Impurity C is an antibacterial drug which functions by inhibiting bacterial RNA polymerase (RNAP), is an impurity of Rifaximin. It also has anti-gram-positive bacterial and mycobacterium activities.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-02634 |
| Pricing | Inquire |
| Cas | 6998-60-3 |
| Molecular Weight | 697.77 |
| Molecular Formula | C37H47NO12 |
| Canonical SMILES | CC1C=CC=C(C(=O)NC2=CC(=C3C(=C2O)C(=C(C4=C3C(=O)C(O4)(OC=CC(C(C(C(C(C(C1O)C)O)C)OC(=O)C)C)OC)C)C)O)O)C |