2-Nitroisophthalic Acid
2-Nitroisophthalic Acid (CAS# 21161-11-5) is an intermediate in the synthesis of 2,6-Dihydroxymethyl Rilpivirine (D446615), which is an analog of Rilpivirine (R509800) a novel non-nucleoside reverse transcriptase inhibitor. Rilpivirine seems to be well tolerated with less CNS disturbance than Efavirenz, and has non-teratogenic potential. An anti-HIV agent.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB016655 |
| Pricing | Inquire |
| Cas | 21161-11-5 |
| Molecular Weight | 211.13 |
| Molecular Formula | C8H5NO6 |
| Canonical SMILES | C1=CC(=C(C(=C1)C(=O)O)[N+](=O)[O-])C(=O)O |