Carbamimidothioic Acid 9-Hydroxynonyl Ester Bromide
Carbamimidothioic Acid 9-Hydroxynonyl Ester Bromide is an intermediate in the preparation of Fulvestrant, which is a selective estrogen receptor degrader (SERD) used to treat hormone receptor (HR)-positive metastatic breast cancer in postmenopausal women.
| Supplier | BOC Sciences |
|---|---|
| Product # | 511545-93-0 |
| Pricing | Inquire |
| Cas | 511545-93-0 |
| Molecular Weight | 299.27 |
| Molecular Formula | C10H23BrN2OS |
| Canonical SMILES | C(CCCCO)CCCCSC(=[NH2+])N.[Br-] |