Galantamine-[d3] hydrobromide
Galantamine-[d3] hydrobromide is the labelled version of Galanthamine. Galanthamine is a selective acetylcholinesterase inhibitor used as a therapeutic agent for the treatment and prevention of Alzheimer's disease and other diseases resulting from reduced neuronal metabolism.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-007099 |
| Pricing | Inquire |
| Cas | 2140262-53-7 |
| Molecular Weight | 371.27 |
| Molecular Formula | C17H19D3BrNO3 |
| Canonical SMILES | CN1CCC23C=CC(CC2OC4=C(C=CC(=C34)C1)OC)O.Br |