Abemaciclib-[d5]
Labelled Abemaciclib. Abemaciclib is an orally available cyclin-dependent kinase (CDK) inhibitor that targets the CDK4 (cyclin D1) and CDK6 (cyclin D3) cell cycle pathway, with potential antineoplastic activity. It is used for the treatment of advanced or metastatic breast cancers.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-003176 |
| Pricing | Inquire |
| Cas | 1809251-51-1 |
| Molecular Weight | 511.62 |
| Molecular Formula | C27H27D5F2N8 |
| Canonical SMILES | CCN1CCN(CC1)CC2=CN=C(C=C2)NC3=NC=C(C(=N3)C4=CC5=C(C(=C4)F)N=C(N5C(C)C)C)F |