1,4-Dibenzoyl-2,3:5,6-di-O-isopropylidene myo-inositol
1,4-Dibenzoyl-2,3:5,6-di-O-isopropylidene myo-inositol, known as a pivotal substance in the biomedical sector, presents a fascinating complexity. Within the realm of drug development, this compound finds widespread utility. It tackles an array of ailments, encompassing cancer, diabetes, and neurologic conditions. Capitalizing on its distinctive chemical attributes, it facilitates the creation of highly effective therapeutic interventions, rendering it an invaluable instrument for both biomedicine exploration and pharmaceutical breakthroughs.
| Supplier | BOC Sciences |
|---|---|
| Product # | 99756-37-3 |
| Pricing | Inquire |
| Cas | 99756-37-3 |
| Molecular Weight | 468.50 |
| Molecular Formula | C26H28O8 |
| Canonical SMILES | CC1(OC2C(O1)C(C3C(C2OC(=O)C4=CC=CC=C4)OC(O3)(C)C)OC(=O)C5=CC=CC=C5)C |