Antifreeze Polypeptide 6 (winter flounder)
Antifreeze polypeptides (AFP) have the common ability to lower the freezing point of serum, thus allowing fish to survive in sub-zero ocean temperatures. Type I AFPs are found in the blood of winter flounder, yellowtail flounder, Alaskan plaice, and the shorthorn and grubby sculpin. AFP37 (HPLC6) is isolated from the winter flounder, Pseudopleuronectes americanus, and consists of 37 amino acids arranged in three 11-residue repeats to form α-helices.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-014689 |
| Pricing | Inquire |
| Cas | 122604-16-4 |
| Molecular Weight | 3242.47 |
| Molecular Formula | C133H225N43O51 |
| Canonical SMILES | CC(C)CC(C(=O)NC(C(C)O)C(=O)NC(C)C(=O)NC(C)C(=O)NC(CC(=O)N)C(=O)NC(C)C(=O)NC(CCCCN)C(=O)NC(C)C(=O)NC(C)C(=O)NC(C)C(=O)NC(CCC(=O)O)C(=O)NC(CC(C)C)C(=O)NC(C(C)O)C(=O)NC(C)C(=O)NC(C)C(=O)NC(CC(=O)N)C(=O)NC(C)C(=O)NC(C)C(=O)NC(C)C(=O)NC(C)C(=O)NC(C)C(=O)NC(C)C(=O)NC(C)C(=O)NC(C(C)O)C(=O)NC(C)C(=O)NC(CCCNC(=N)N)C(=O)O)NC(=O)C(C)NC(=O)C(C)NC(=O)C(C)NC(=O)C(C)NC(=O)C(C)NC(=O)C(C)NC(=O)C(CC(=O)O)NC(=O)C(CO)NC(=O)C(C)NC(=O)C(C(C)O)NC(=O)C(CC(=O)O)N |